C50H74N2O6 — CID 123595482
methyl (2S,3R)-3-[(2S)-2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoyl]oxy-2-(icosa-5,8,11,14,17-pentaenoylamino)butanoate (PubChem CID 123595482) has the molecular formula C50H74N2O6 and a molecular weight of 799.15 g/mol. Its IUPAC name is methyl (2S,3R)-3-[(2S)-2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoyl]oxy-2-(icosa-5,8,11,14,17-pentaenoylamino)butanoate.
| Compound Name | methyl (2S,3R)-3-[(2S)-2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoyl]oxy-2-(icosa-5,8,11,14,17-pentaenoylamino)butanoate |
|---|---|
| PubChem CID | 123595482 |
| Molecular Formula | C50H74N2O6 |
| Molecular Weight | 799.15 g/mol |
| Exact Mass | 798.55 |
| IUPAC Name | methyl (2S,3R)-3-[(2S)-2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoyl]oxy-2-(icosa-5,8,11,14,17-pentaenoylamino)butanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)N[C@@H](C)C(=O)O[C@H](C)[C@H](NC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)C(=O)OC |
| InChI | InChI=1S/C50H74N2O6/c1-6-8-10-12-14-16-18-20-22-24-25-27-29-30-32-34-36-38-40-42-46(53)51-44(3)49(55)58-45(4)48(50(56)57-5)52-47(54)43-41-39-37-35-33-31-28-26-23-21-19-17-15-13-11-9-7-2/h8-11,14-17,20-23,25,27-28,30-32,35-38,44-45,48H,6-7,12-13,18-19,24,26,29,33-34,39-43H2,1-5H3,(H,51,53)(H,52,54)/t44-,45+,48-/m0/s1 |
| InChIKey | WTBSRXRSNGMZRM-VVQUBFBXSA-N |
| XLogP | 11.48 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.15 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|