C29H45NO3 — CID 72539769
methyl 2-(docosa-4,7,10,13,16,19-hexaenoylamino)-4-methylpentanoate (PubChem CID 72539769) has the molecular formula C29H45NO3 and a molecular weight of 455.68 g/mol. Its IUPAC name is methyl 2-(docosa-4,7,10,13,16,19-hexaenoylamino)-4-methylpentanoate.
| Compound Name | methyl 2-(docosa-4,7,10,13,16,19-hexaenoylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 72539769 |
| Molecular Formula | C29H45NO3 |
| Molecular Weight | 455.68 g/mol |
| Exact Mass | 455.34 |
| IUPAC Name | methyl 2-(docosa-4,7,10,13,16,19-hexaenoylamino)-4-methylpentanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NC(CC(C)C)C(=O)OC |
| InChI | InChI=1S/C29H45NO3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-28(31)30-27(25-26(2)3)29(32)33-4/h6-7,9-10,12-13,15-16,18-19,21-22,26-27H,5,8,11,14,17,20,23-25H2,1-4H3,(H,30,31) |
| InChIKey | DHPSPAIIVTUZBC-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.68 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|