C29H47NO2 — CID 129181068
(7Z,10Z,13Z,16Z,19Z)-N-(5-methyl-2-oxohexan-3-yl)docosa-7,10,13,16,19-pentaenamide (PubChem CID 129181068) has the molecular formula C29H47NO2 and a molecular weight of 441.70 g/mol. Its IUPAC name is (7Z,10Z,13Z,16Z,19Z)-N-(5-methyl-2-oxohexan-3-yl)docosa-7,10,13,16,19-pentaenamide.
| Compound Name | (7Z,10Z,13Z,16Z,19Z)-N-(5-methyl-2-oxohexan-3-yl)docosa-7,10,13,16,19-pentaenamide |
|---|---|
| PubChem CID | 129181068 |
| Molecular Formula | C29H47NO2 |
| Molecular Weight | 441.70 g/mol |
| Exact Mass | 441.36 |
| IUPAC Name | (7Z,10Z,13Z,16Z,19Z)-N-(5-methyl-2-oxohexan-3-yl)docosa-7,10,13,16,19-pentaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)NC(CC(C)C)C(C)=O |
| InChI | InChI=1S/C29H47NO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-29(32)30-28(27(4)31)25-26(2)3/h6-7,9-10,12-13,15-16,18-19,26,28H,5,8,11,14,17,20-25H2,1-4H3,(H,30,32)/b7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | YXCFNYUOUWOHML-WMPRHZDHSA-N |
| XLogP | 7.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.70 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|