C24H45NO2 — CID 123156271
N-[(2S)-1-hydroxy-4-methylpentan-2-yl]octadeca-9,12-dienamide (PubChem CID 123156271) has the molecular formula C24H45NO2 and a molecular weight of 379.63 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-4-methylpentan-2-yl]octadeca-9,12-dienamide.
| Compound Name | N-[(2S)-1-hydroxy-4-methylpentan-2-yl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 123156271 |
| Molecular Formula | C24H45NO2 |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 379.35 |
| IUPAC Name | N-[(2S)-1-hydroxy-4-methylpentan-2-yl]octadeca-9,12-dienamide |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)N[C@H](CO)CC(C)C |
| InChI | InChI=1S/C24H45NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(27)25-23(21-26)20-22(2)3/h8-9,11-12,22-23,26H,4-7,10,13-21H2,1-3H3,(H,25,27)/t23-/m0/s1 |
| InChIKey | PNZFQJYINJPXEU-QHCPKHFHSA-N |
| XLogP | 6.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|