C25H47NO2 — CID 143858807
(9Z,12Z)-N-[(2R)-1-hydroxy-5-methylhexan-2-yl]octadeca-9,12-dienamide (PubChem CID 143858807) has the molecular formula C25H47NO2 and a molecular weight of 393.66 g/mol. Its IUPAC name is (9Z,12Z)-N-[(2R)-1-hydroxy-5-methylhexan-2-yl]octadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N-[(2R)-1-hydroxy-5-methylhexan-2-yl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 143858807 |
| Molecular Formula | C25H47NO2 |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 393.36 |
| IUPAC Name | (9Z,12Z)-N-[(2R)-1-hydroxy-5-methylhexan-2-yl]octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)N[C@@H](CO)CCC(C)C |
| InChI | InChI=1S/C25H47NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(28)26-24(22-27)21-20-23(2)3/h8-9,11-12,23-24,27H,4-7,10,13-22H2,1-3H3,(H,26,28)/b9-8-,12-11-/t24-/m1/s1 |
| InChIKey | MQFWLNPGPJMDSL-XTVBGRGASA-N |
| XLogP | 6.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|