C18H33NOSi — CID 123430456
N-silyloctadeca-9,12,15-trienamide (PubChem CID 123430456) has the molecular formula C18H33NOSi and a molecular weight of 307.55 g/mol. Its IUPAC name is N-silyloctadeca-9,12,15-trienamide.
| Compound Name | N-silyloctadeca-9,12,15-trienamide |
|---|---|
| PubChem CID | 123430456 |
| Molecular Formula | C18H33NOSi |
| Molecular Weight | 307.55 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-silyloctadeca-9,12,15-trienamide |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)N[SiH3] |
| InChI | InChI=1S/C18H33NOSi/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)19-21/h3-4,6-7,9-10H,2,5,8,11-17H2,1,21H3,(H,19,20) |
| InChIKey | YOIRKMJXFDSNQL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|