C20H33NO — CID 90956698
N-ethenyloctadeca-9,12,15-trienamide (PubChem CID 90956698) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is N-ethenyloctadeca-9,12,15-trienamide.
| Compound Name | N-ethenyloctadeca-9,12,15-trienamide |
|---|---|
| PubChem CID | 90956698 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | N-ethenyloctadeca-9,12,15-trienamide |
| SMILES | C=CNC(=O)CCCCCCCC=CCC=CCC=CCC |
| InChI | InChI=1S/C20H33NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(22)21-4-2/h4-6,8-9,11-12H,2-3,7,10,13-19H2,1H3,(H,21,22) |
| InChIKey | GHEQNHXFNIKANL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|