C23H43NO4 — CID 169210967
methyl (2S,3S)-3-hydroxy-2-[[(Z)-octadec-9-enoyl]amino]butanoate (PubChem CID 169210967) has the molecular formula C23H43NO4 and a molecular weight of 397.60 g/mol. Its IUPAC name is methyl (2S,3S)-3-hydroxy-2-[[(Z)-octadec-9-enoyl]amino]butanoate.
| Compound Name | methyl (2S,3S)-3-hydroxy-2-[[(Z)-octadec-9-enoyl]amino]butanoate |
|---|---|
| PubChem CID | 169210967 |
| Molecular Formula | C23H43NO4 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.32 |
| IUPAC Name | methyl (2S,3S)-3-hydroxy-2-[[(Z)-octadec-9-enoyl]amino]butanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](C(=O)OC)[C@H](C)O |
| InChI | InChI=1S/C23H43NO4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(26)24-22(20(2)25)23(27)28-3/h11-12,20,22,25H,4-10,13-19H2,1-3H3,(H,24,26)/b12-11-/t20-,22-/m0/s1 |
| InChIKey | CXGXTZXRAYPIBF-LAXMDVRKSA-N |
| XLogP | 5.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|