C30H39NO2 — CID 123665751
N-phenacyldocosa-4,7,10,13,16,19-hexaenamide (PubChem CID 123665751) has the molecular formula C30H39NO2 and a molecular weight of 445.65 g/mol. Its IUPAC name is N-phenacyldocosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | N-phenacyldocosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 123665751 |
| Molecular Formula | C30H39NO2 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | N-phenacyldocosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-26-30(33)31-27-29(32)28-24-21-20-22-25-28/h3-4,6-7,9-10,12-13,15-16,18-22,24-25H,2,5,8,11,14,17,23,26-27H2,1H3,(H,31,33) |
| InChIKey | JOGAJFJQRUDWAQ-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|