C35H48N2O3 — CID 118000546
2-hydroxy-N-[1-[[(4Z,7Z,10Z,13Z,16Z,19Z,22Z)-pentacosa-4,7,10,13,16,19,22-heptaenoyl]amino]propan-2-yl]benzamide (PubChem CID 118000546) has the molecular formula C35H48N2O3 and a molecular weight of 544.78 g/mol. Its IUPAC name is 2-hydroxy-N-[1-[[(4Z,7Z,10Z,13Z,16Z,19Z,22Z)-pentacosa-4,7,10,13,16,19,22-heptaenoyl]amino]propan-2-yl]benzamide.
| Compound Name | 2-hydroxy-N-[1-[[(4Z,7Z,10Z,13Z,16Z,19Z,22Z)-pentacosa-4,7,10,13,16,19,22-heptaenoyl]amino]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 118000546 |
| Molecular Formula | C35H48N2O3 |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.37 |
| IUPAC Name | 2-hydroxy-N-[1-[[(4Z,7Z,10Z,13Z,16Z,19Z,22Z)-pentacosa-4,7,10,13,16,19,22-heptaenoyl]amino]propan-2-yl]benzamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCC(C)NC(=O)c1ccccc1O |
| InChI | InChI=1S/C35H48N2O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-29-34(39)36-30-31(2)37-35(40)32-27-25-26-28-33(32)38/h4-5,7-8,10-11,13-14,16-17,19-20,22-23,25-28,31,38H,3,6,9,12,15,18,21,24,29-30H2,1-2H3,(H,36,39)(H,37,40)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | HWBJTGKVMXDIRX-IIBCDDELSA-N |
| XLogP | 8.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|