C28H40N2O4 — CID 67325861
2-hydroxy-N-[2-[2-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenoxy]butanoylamino]ethyl]benzamide (PubChem CID 67325861) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is 2-hydroxy-N-[2-[2-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenoxy]butanoylamino]ethyl]benzamide.
| Compound Name | 2-hydroxy-N-[2-[2-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenoxy]butanoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 67325861 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 2-hydroxy-N-[2-[2-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenoxy]butanoylamino]ethyl]benzamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCOC(CC)C(=O)NCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C28H40N2O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-18-23-34-26(4-2)28(33)30-22-21-29-27(32)24-19-16-17-20-25(24)31/h5-6,8-9,11-12,14-17,19-20,26,31H,3-4,7,10,13,18,21-23H2,1-2H3,(H,29,32)(H,30,33)/b6-5-,9-8-,12-11-,15-14- |
| InChIKey | KGIFFOITAKOBKS-AFSLFLIVSA-N |
| XLogP | 5.23 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|