C26H44N2O2 — CID 86676978
N-(2-aminoethyl)-2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanamide (PubChem CID 86676978) has the molecular formula C26H44N2O2 and a molecular weight of 416.65 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanamide.
| Compound Name | N-(2-aminoethyl)-2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanamide |
|---|---|
| PubChem CID | 86676978 |
| Molecular Formula | C26H44N2O2 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.34 |
| IUPAC Name | N-(2-aminoethyl)-2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(CC)C(=O)NCCN |
| InChI | InChI=1S/C26H44N2O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-30-25(4-2)26(29)28-23-22-27/h5-6,8-9,11-12,14-15,17-18,25H,3-4,7,10,13,16,19-24,27H2,1-2H3,(H,28,29)/b6-5-,9-8-,12-11-,15-14-,18-17- |
| InChIKey | ATULPQATBDNKCC-AAQCHOMXSA-N |
| XLogP | 5.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|