C28H47NO5 — CID 87561466
[2-amino-3-hydroxy-2-(hydroxymethyl)propyl] 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanoate (PubChem CID 87561466) has the molecular formula C28H47NO5 and a molecular weight of 477.69 g/mol. Its IUPAC name is [2-amino-3-hydroxy-2-(hydroxymethyl)propyl] 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanoate.
| Compound Name | [2-amino-3-hydroxy-2-(hydroxymethyl)propyl] 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanoate |
|---|---|
| PubChem CID | 87561466 |
| Molecular Formula | C28H47NO5 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.35 |
| IUPAC Name | [2-amino-3-hydroxy-2-(hydroxymethyl)propyl] 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(CC)C(=O)OCC(N)(CO)CO |
| InChI | InChI=1S/C28H47NO5/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-33-26(4-2)27(32)34-25-28(29,23-30)24-31/h5-6,8-9,11-12,14-15,17-18,26,30-31H,3-4,7,10,13,16,19-25,29H2,1-2H3/b6-5-,9-8-,12-11-,15-14-,18-17- |
| InChIKey | QUQDUBNTNPFGDC-AAQCHOMXSA-N |
| XLogP | 4.93 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|