C22H38O3 — CID 138680323
2-[(8Z,11Z,14Z)-octadeca-8,11,14-trienoxy]butanoic acid (PubChem CID 138680323) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is 2-[(8Z,11Z,14Z)-octadeca-8,11,14-trienoxy]butanoic acid.
| Compound Name | 2-[(8Z,11Z,14Z)-octadeca-8,11,14-trienoxy]butanoic acid |
|---|---|
| PubChem CID | 138680323 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | 2-[(8Z,11Z,14Z)-octadeca-8,11,14-trienoxy]butanoic acid |
| SMILES | CCC/C=C\C/C=C\C/C=C\CCCCCCCOC(CC)C(=O)O |
| InChI | InChI=1S/C22H38O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-21(4-2)22(23)24/h6-7,9-10,12-13,21H,3-5,8,11,14-20H2,1-2H3,(H,23,24)/b7-6-,10-9-,13-12- |
| InChIKey | SHYZYUJGOUIYQG-QNEBEIHSSA-N |
| XLogP | 6.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|