C24H37KO3 — CID 173108127
potassium 2-icosa-5,8,11,14,17-pentaenoxybutanoate (PubChem CID 173108127) has the molecular formula C24H37KO3 and a molecular weight of 412.66 g/mol. Its IUPAC name is potassium 2-icosa-5,8,11,14,17-pentaenoxybutanoate.
| Compound Name | potassium 2-icosa-5,8,11,14,17-pentaenoxybutanoate |
|---|---|
| PubChem CID | 173108127 |
| Molecular Formula | C24H37KO3 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | potassium 2-icosa-5,8,11,14,17-pentaenoxybutanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCOC(CC)C(=O)[O-].[K+] |
| InChI | InChI=1S/C24H38O3.K/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27-23(4-2)24(25)26;/h5-6,8-9,11-12,14-15,17-18,23H,3-4,7,10,13,16,19-22H2,1-2H3,(H,25,26);/q;+1/p-1 |
| InChIKey | GGHLLRBNRREEIA-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|