C31H45NO2 — CID 138680191
N-benzyl-2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanamide (PubChem CID 138680191) has the molecular formula C31H45NO2 and a molecular weight of 463.71 g/mol. Its IUPAC name is N-benzyl-2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanamide.
| Compound Name | N-benzyl-2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanamide |
|---|---|
| PubChem CID | 138680191 |
| Molecular Formula | C31H45NO2 |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 463.35 |
| IUPAC Name | N-benzyl-2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(CC)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C31H45NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-27-34-30(4-2)31(33)32-28-29-25-22-21-23-26-29/h5-6,8-9,11-12,14-15,17-18,21-23,25-26,30H,3-4,7,10,13,16,19-20,24,27-28H2,1-2H3,(H,32,33)/b6-5-,9-8-,12-11-,15-14-,18-17- |
| InChIKey | BOTVKUXEDBZMBY-AAQCHOMXSA-N |
| XLogP | 8.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|