C29H42O5 — CID 77473509
2-(2-octadeca-9,12,15-trienoxybutanoyloxy)benzoic acid (PubChem CID 77473509) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is 2-(2-octadeca-9,12,15-trienoxybutanoyloxy)benzoic acid.
| Compound Name | 2-(2-octadeca-9,12,15-trienoxybutanoyloxy)benzoic acid |
|---|---|
| PubChem CID | 77473509 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 2-(2-octadeca-9,12,15-trienoxybutanoyloxy)benzoic acid |
| SMILES | CCC=CCC=CCC=CCCCCCCCCOC(CC)C(=O)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C29H42O5/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-24-33-26(4-2)29(32)34-27-23-20-19-22-25(27)28(30)31/h5-6,8-9,11-12,19-20,22-23,26H,3-4,7,10,13-18,21,24H2,1-2H3,(H,30,31) |
| InChIKey | KFNYRTMHWKSJTN-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|