C30H44O5 — CID 159295822
2-hydroxy-5-[3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]-2-oxopentyl]benzoic acid (PubChem CID 159295822) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is 2-hydroxy-5-[3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]-2-oxopentyl]benzoic acid.
| Compound Name | 2-hydroxy-5-[3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]-2-oxopentyl]benzoic acid |
|---|---|
| PubChem CID | 159295822 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 2-hydroxy-5-[3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoxy]-2-oxopentyl]benzoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCOC(CC)C(=O)Cc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C30H44O5/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-35-29(4-2)28(32)24-25-20-21-27(31)26(23-25)30(33)34/h5-6,8-9,11-12,20-21,23,29,31H,3-4,7,10,13-19,22,24H2,1-2H3,(H,33,34)/b6-5-,9-8-,12-11- |
| InChIKey | LARYEWASPJPRFU-AGRJPVHOSA-N |
| XLogP | 7.59 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|