C39H56N2O6 — CID 71257180
5-[[2-(2-docosa-4,7,10,13,16,19-hexaenoxybutanoylamino)-4-methylpentanoyl]amino]-2-hydroxybenzoic acid (PubChem CID 71257180) has the molecular formula C39H56N2O6 and a molecular weight of 648.89 g/mol. Its IUPAC name is 5-[[2-(2-docosa-4,7,10,13,16,19-hexaenoxybutanoylamino)-4-methylpentanoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-(2-docosa-4,7,10,13,16,19-hexaenoxybutanoylamino)-4-methylpentanoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 71257180 |
| Molecular Formula | C39H56N2O6 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 648.41 |
| IUPAC Name | 5-[[2-(2-docosa-4,7,10,13,16,19-hexaenoxybutanoylamino)-4-methylpentanoyl]amino]-2-hydroxybenzoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCCOC(CC)C(=O)NC(CC(C)C)C(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C39H56N2O6/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-28-47-36(6-2)38(44)41-34(29-31(3)4)37(43)40-32-26-27-35(42)33(30-32)39(45)46/h7-8,10-11,13-14,16-17,19-20,22-23,26-27,30-31,34,36,42H,5-6,9,12,15,18,21,24-25,28-29H2,1-4H3,(H,40,43)(H,41,44)(H,45,46) |
| InChIKey | HZGSPTCPRUEEJI-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|