C33H46N2O8 — CID 77473804
2-hydroxy-5-[2-[(2-icosa-5,8,11,14,17-pentaenoxy-2-methoxyacetyl)amino]ethoxycarbonylamino]benzoic acid (PubChem CID 77473804) has the molecular formula C33H46N2O8 and a molecular weight of 598.74 g/mol. Its IUPAC name is 2-hydroxy-5-[2-[(2-icosa-5,8,11,14,17-pentaenoxy-2-methoxyacetyl)amino]ethoxycarbonylamino]benzoic acid.
| Compound Name | 2-hydroxy-5-[2-[(2-icosa-5,8,11,14,17-pentaenoxy-2-methoxyacetyl)amino]ethoxycarbonylamino]benzoic acid |
|---|---|
| PubChem CID | 77473804 |
| Molecular Formula | C33H46N2O8 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | 2-hydroxy-5-[2-[(2-icosa-5,8,11,14,17-pentaenoxy-2-methoxyacetyl)amino]ethoxycarbonylamino]benzoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCOC(OC)C(=O)NCCOC(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C33H46N2O8/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-42-32(41-2)30(37)34-23-25-43-33(40)35-27-21-22-29(36)28(26-27)31(38)39/h4-5,7-8,10-11,13-14,16-17,21-22,26,32,36H,3,6,9,12,15,18-20,23-25H2,1-2H3,(H,34,37)(H,35,40)(H,38,39) |
| InChIKey | VFLSTNNMTGUTON-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|