C34H48N2O6S — CID 158420761
2-hydroxy-5-[[5-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]sulfanyl-5-methoxy-4-oxopentyl]carbamoylamino]benzoic acid (PubChem CID 158420761) has the molecular formula C34H48N2O6S and a molecular weight of 612.83 g/mol. Its IUPAC name is 2-hydroxy-5-[[5-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]sulfanyl-5-methoxy-4-oxopentyl]carbamoylamino]benzoic acid.
| Compound Name | 2-hydroxy-5-[[5-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]sulfanyl-5-methoxy-4-oxopentyl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 158420761 |
| Molecular Formula | C34H48N2O6S |
| Molecular Weight | 612.83 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | 2-hydroxy-5-[[5-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]sulfanyl-5-methoxy-4-oxopentyl]carbamoylamino]benzoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCSC(OC)C(=O)CCCNC(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C34H48N2O6S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26-43-33(42-2)31(38)22-21-25-35-34(41)36-28-23-24-30(37)29(27-28)32(39)40/h4-5,7-8,10-11,13-14,16-17,23-24,27,33,37H,3,6,9,12,15,18-22,25-26H2,1-2H3,(H,39,40)(H2,35,36,41)/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | HALQASVRVOCQDY-JEBPEJKESA-N |
| XLogP | 8.19 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.83 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|