C12H13F3N2O4 — CID 115521245
2-hydroxy-5-(4,4,4-trifluorobutylcarbamoylamino)benzoic acid (PubChem CID 115521245) has the molecular formula C12H13F3N2O4 and a molecular weight of 306.24 g/mol. Its IUPAC name is 2-hydroxy-5-(4,4,4-trifluorobutylcarbamoylamino)benzoic acid.
| Compound Name | 2-hydroxy-5-(4,4,4-trifluorobutylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 115521245 |
| Molecular Formula | C12H13F3N2O4 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-hydroxy-5-(4,4,4-trifluorobutylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCCCC(F)(F)F)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H13F3N2O4/c13-12(14,15)4-1-5-16-11(21)17-7-2-3-9(18)8(6-7)10(19)20/h2-3,6,18H,1,4-5H2,(H,19,20)(H2,16,17,21) |
| InChIKey | GZEYYKZUDKYFEL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|