C11H14FN3O3 — CID 62273492
5-(3-aminopropylcarbamoylamino)-2-fluorobenzoic acid (PubChem CID 62273492) has the molecular formula C11H14FN3O3 and a molecular weight of 255.25 g/mol. Its IUPAC name is 5-(3-aminopropylcarbamoylamino)-2-fluorobenzoic acid.
| Compound Name | 5-(3-aminopropylcarbamoylamino)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 62273492 |
| Molecular Formula | C11H14FN3O3 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 5-(3-aminopropylcarbamoylamino)-2-fluorobenzoic acid |
| SMILES | NCCCNC(=O)Nc1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H14FN3O3/c12-9-3-2-7(6-8(9)10(16)17)15-11(18)14-5-1-4-13/h2-3,6H,1,4-5,13H2,(H,16,17)(H2,14,15,18) |
| InChIKey | KCXCUYNFRVXXBU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|