C10H8F3NO4 — CID 16777039
2-hydroxy-5-(3,3,3-trifluoropropanoylamino)benzoic acid (PubChem CID 16777039) has the molecular formula C10H8F3NO4 and a molecular weight of 263.17 g/mol. Its IUPAC name is 2-hydroxy-5-(3,3,3-trifluoropropanoylamino)benzoic acid.
| Compound Name | 2-hydroxy-5-(3,3,3-trifluoropropanoylamino)benzoic acid |
|---|---|
| PubChem CID | 16777039 |
| Molecular Formula | C10H8F3NO4 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-hydroxy-5-(3,3,3-trifluoropropanoylamino)benzoic acid |
| SMILES | O=C(CC(F)(F)F)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C10H8F3NO4/c11-10(12,13)4-8(16)14-5-1-2-7(15)6(3-5)9(17)18/h1-3,15H,4H2,(H,14,16)(H,17,18) |
| InChIKey | HEZDRXLYZQNRSJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|