C17H14F3NO4 — CID 4972507
2-hydroxy-5-[3-[3-(trifluoromethyl)phenyl]propanoylamino]benzoic acid (PubChem CID 4972507) has the molecular formula C17H14F3NO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is 2-hydroxy-5-[3-[3-(trifluoromethyl)phenyl]propanoylamino]benzoic acid.
| Compound Name | 2-hydroxy-5-[3-[3-(trifluoromethyl)phenyl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 4972507 |
| Molecular Formula | C17H14F3NO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-hydroxy-5-[3-[3-(trifluoromethyl)phenyl]propanoylamino]benzoic acid |
| SMILES | O=C(CCc1cccc(C(F)(F)F)c1)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H14F3NO4/c18-17(19,20)11-3-1-2-10(8-11)4-7-15(23)21-12-5-6-14(22)13(9-12)16(24)25/h1-3,5-6,8-9,22H,4,7H2,(H,21,23)(H,24,25) |
| InChIKey | OSZRJCGYOHHRHL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|