C16H17NO4 — CID 167095026
5-(3-cyclohexa-1,5-dien-1-ylpropanoylamino)-2-hydroxybenzoic acid (PubChem CID 167095026) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-(3-cyclohexa-1,5-dien-1-ylpropanoylamino)-2-hydroxybenzoic acid.
| Compound Name | 5-(3-cyclohexa-1,5-dien-1-ylpropanoylamino)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 167095026 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 5-(3-cyclohexa-1,5-dien-1-ylpropanoylamino)-2-hydroxybenzoic acid |
| SMILES | O=C(CCC1=CCCC=C1)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H17NO4/c18-14-8-7-12(10-13(14)16(20)21)17-15(19)9-6-11-4-2-1-3-5-11/h2,4-5,7-8,10,18H,1,3,6,9H2,(H,17,19)(H,20,21) |
| InChIKey | AOPVEIDHOLMGPF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|