C12H14N2O5S — CID 43353116
5-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-2-hydroxybenzoic acid (PubChem CID 43353116) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 5-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 43353116 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 5-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-2-hydroxybenzoic acid |
| SMILES | NC(=O)CSCCC(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H14N2O5S/c13-10(16)6-20-4-3-11(17)14-7-1-2-9(15)8(5-7)12(18)19/h1-2,5,15H,3-4,6H2,(H2,13,16)(H,14,17)(H,18,19) |
| InChIKey | XUAQRUAXFNPTKG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|