C12H16N2O4S2 — CID 63614494
2-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-5-ethylthiophene-3-carboxylic acid (PubChem CID 63614494) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-5-ethylthiophene-3-carboxylic acid.
| Compound Name | 2-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-5-ethylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63614494 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-5-ethylthiophene-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)c(NC(=O)CCSCC(N)=O)s1 |
| InChI | InChI=1S/C12H16N2O4S2/c1-2-7-5-8(12(17)18)11(20-7)14-10(16)3-4-19-6-9(13)15/h5H,2-4,6H2,1H3,(H2,13,15)(H,14,16)(H,17,18) |
| InChIKey | HRLNRUWPCGUDAE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|