C11H14N2O3S — CID 55249146
2-(cyclopropylcarbamoylamino)-5-ethylthiophene-3-carboxylic acid (PubChem CID 55249146) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-(cyclopropylcarbamoylamino)-5-ethylthiophene-3-carboxylic acid.
| Compound Name | 2-(cyclopropylcarbamoylamino)-5-ethylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 55249146 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-(cyclopropylcarbamoylamino)-5-ethylthiophene-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)c(NC(=O)NC2CC2)s1 |
| InChI | InChI=1S/C11H14N2O3S/c1-2-7-5-8(10(14)15)9(17-7)13-11(16)12-6-3-4-6/h5-6H,2-4H2,1H3,(H,14,15)(H2,12,13,16) |
| InChIKey | YRZNXWSDRKPXSY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |