C14H15NO3S2 — CID 63615151
5-ethyl-2-[(3-ethylthiophene-2-carbonyl)amino]thiophene-3-carboxylic acid (PubChem CID 63615151) has the molecular formula C14H15NO3S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 5-ethyl-2-[(3-ethylthiophene-2-carbonyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 5-ethyl-2-[(3-ethylthiophene-2-carbonyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63615151 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 5-ethyl-2-[(3-ethylthiophene-2-carbonyl)amino]thiophene-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)c(NC(=O)c2sccc2CC)s1 |
| InChI | InChI=1S/C14H15NO3S2/c1-3-8-5-6-19-11(8)12(16)15-13-10(14(17)18)7-9(4-2)20-13/h5-7H,3-4H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | JOSMDTPQICEZKV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |