C12H11NO3S2 — CID 63616182
5-ethyl-2-(thiophene-3-carbonylamino)thiophene-3-carboxylic acid (PubChem CID 63616182) has the molecular formula C12H11NO3S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-ethyl-2-(thiophene-3-carbonylamino)thiophene-3-carboxylic acid.
| Compound Name | 5-ethyl-2-(thiophene-3-carbonylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63616182 |
| Molecular Formula | C12H11NO3S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 5-ethyl-2-(thiophene-3-carbonylamino)thiophene-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)c(NC(=O)c2ccsc2)s1 |
| InChI | InChI=1S/C12H11NO3S2/c1-2-8-5-9(12(15)16)11(18-8)13-10(14)7-3-4-17-6-7/h3-6H,2H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | HOBMQVXFKHSCAU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |