C11H11N3O3S — CID 63614496
5-ethyl-2-(1H-pyrazole-4-carbonylamino)thiophene-3-carboxylic acid (PubChem CID 63614496) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 5-ethyl-2-(1H-pyrazole-4-carbonylamino)thiophene-3-carboxylic acid.
| Compound Name | 5-ethyl-2-(1H-pyrazole-4-carbonylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63614496 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 5-ethyl-2-(1H-pyrazole-4-carbonylamino)thiophene-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)c(NC(=O)c2cn[nH]c2)s1 |
| InChI | InChI=1S/C11H11N3O3S/c1-2-7-3-8(11(16)17)10(18-7)14-9(15)6-4-12-13-5-6/h3-5H,2H2,1H3,(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | KXAZTRAZMXBBPF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |