C14H11Cl2NO3S — CID 63616464
2-[(2,4-dichlorobenzoyl)amino]-5-ethylthiophene-3-carboxylic acid (PubChem CID 63616464) has the molecular formula C14H11Cl2NO3S and a molecular weight of 344.22 g/mol. Its IUPAC name is 2-[(2,4-dichlorobenzoyl)amino]-5-ethylthiophene-3-carboxylic acid.
| Compound Name | 2-[(2,4-dichlorobenzoyl)amino]-5-ethylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63616464 |
| Molecular Formula | C14H11Cl2NO3S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 2-[(2,4-dichlorobenzoyl)amino]-5-ethylthiophene-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)c(NC(=O)c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C14H11Cl2NO3S/c1-2-8-6-10(14(19)20)13(21-8)17-12(18)9-4-3-7(15)5-11(9)16/h3-6H,2H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | IFIRWHIURVSHST-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |