C15H14ClNO4S — CID 28858939
2-[[2-(4-chlorophenoxy)acetyl]amino]-5-ethylthiophene-3-carboxylic acid (PubChem CID 28858939) has the molecular formula C15H14ClNO4S and a molecular weight of 339.80 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenoxy)acetyl]amino]-5-ethylthiophene-3-carboxylic acid.
| Compound Name | 2-[[2-(4-chlorophenoxy)acetyl]amino]-5-ethylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 28858939 |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-[[2-(4-chlorophenoxy)acetyl]amino]-5-ethylthiophene-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)c(NC(=O)COc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C15H14ClNO4S/c1-2-11-7-12(15(19)20)14(22-11)17-13(18)8-21-10-5-3-9(16)4-6-10/h3-7H,2,8H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | NCTCJSZGVVTHNG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |