C24H22N2O4S — CID 16521235
ethyl 2-[[2-[4-(4-cyanophenyl)phenoxy]acetyl]amino]-5-ethylthiophene-3-carboxylate (PubChem CID 16521235) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is ethyl 2-[[2-[4-(4-cyanophenyl)phenoxy]acetyl]amino]-5-ethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[4-(4-cyanophenyl)phenoxy]acetyl]amino]-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 16521235 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | ethyl 2-[[2-[4-(4-cyanophenyl)phenoxy]acetyl]amino]-5-ethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)COc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O4S/c1-3-20-13-21(24(28)29-4-2)23(31-20)26-22(27)15-30-19-11-9-18(10-12-19)17-7-5-16(14-25)6-8-17/h5-13H,3-4,15H2,1-2H3,(H,26,27) |
| InChIKey | XJRMMLDPAHMVQN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |