C20H17NO4S — CID 28860626
2-[[2-(4-methylphenoxy)acetyl]amino]-5-phenylthiophene-3-carboxylic acid (PubChem CID 28860626) has the molecular formula C20H17NO4S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[[2-(4-methylphenoxy)acetyl]amino]-5-phenylthiophene-3-carboxylic acid.
| Compound Name | 2-[[2-(4-methylphenoxy)acetyl]amino]-5-phenylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 28860626 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-[[2-(4-methylphenoxy)acetyl]amino]-5-phenylthiophene-3-carboxylic acid |
| SMILES | Cc1ccc(OCC(=O)Nc2sc(-c3ccccc3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C20H17NO4S/c1-13-7-9-15(10-8-13)25-12-18(22)21-19-16(20(23)24)11-17(26-19)14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | KSKVFWUSIUIAIZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_G(2)', 'substructure': 'N/A'} |
|---|