C16H17NO4S — CID 733295
ethyl 2-[(2-methoxyacetyl)amino]-5-phenylthiophene-3-carboxylate (PubChem CID 733295) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is ethyl 2-[(2-methoxyacetyl)amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-methoxyacetyl)amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 733295 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | ethyl 2-[(2-methoxyacetyl)amino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=O)COC |
| InChI | InChI=1S/C16H17NO4S/c1-3-21-16(19)12-9-13(11-7-5-4-6-8-11)22-15(12)17-14(18)10-20-2/h4-9H,3,10H2,1-2H3,(H,17,18) |
| InChIKey | REAZNNATVRIACD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |