C19H25N2O3S+ — CID 2097675
[(2R)-butan-2-yl]-[2-[(3-ethoxycarbonyl-5-phenylthiophen-2-yl)amino]-2-oxoethyl]azanium (PubChem CID 2097675) has the molecular formula C19H25N2O3S+ and a molecular weight of 361.49 g/mol. Its IUPAC name is [(2R)-butan-2-yl]-[2-[(3-ethoxycarbonyl-5-phenylthiophen-2-yl)amino]-2-oxoethyl]azanium.
| Compound Name | [(2R)-butan-2-yl]-[2-[(3-ethoxycarbonyl-5-phenylthiophen-2-yl)amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2097675 |
| Molecular Formula | C19H25N2O3S+ |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [(2R)-butan-2-yl]-[2-[(3-ethoxycarbonyl-5-phenylthiophen-2-yl)amino]-2-oxoethyl]azanium |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=O)C[NH2+][C@H](C)CC |
| InChI | InChI=1S/C19H24N2O3S/c1-4-13(3)20-12-17(22)21-18-15(19(23)24-5-2)11-16(25-18)14-9-7-6-8-10-14/h6-11,13,20H,4-5,12H2,1-3H3,(H,21,22)/p+1/t13-/m1/s1 |
| InChIKey | OJTKPZPGHSNOJW-CYBMUJFWSA-O |
| XLogP | 2.89 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |