C19H21NO5S — CID 46094676
ethyl 2-[(5-methoxy-5-oxopentanoyl)amino]-5-phenylthiophene-3-carboxylate (PubChem CID 46094676) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is ethyl 2-[(5-methoxy-5-oxopentanoyl)amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(5-methoxy-5-oxopentanoyl)amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 46094676 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | ethyl 2-[(5-methoxy-5-oxopentanoyl)amino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=O)CCCC(=O)OC |
| InChI | InChI=1S/C19H21NO5S/c1-3-25-19(23)14-12-15(13-8-5-4-6-9-13)26-18(14)20-16(21)10-7-11-17(22)24-2/h4-6,8-9,12H,3,7,10-11H2,1-2H3,(H,20,21) |
| InChIKey | VQFCDGHGDJRRSK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |