C18H20N2O3S3 — CID 2477496
ethyl 2-[[2-(dimethylcarbamothioylsulfanyl)acetyl]amino]-5-phenylthiophene-3-carboxylate (PubChem CID 2477496) has the molecular formula C18H20N2O3S3 and a molecular weight of 408.57 g/mol. Its IUPAC name is ethyl 2-[[2-(dimethylcarbamothioylsulfanyl)acetyl]amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(dimethylcarbamothioylsulfanyl)acetyl]amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2477496 |
| Molecular Formula | C18H20N2O3S3 |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | ethyl 2-[[2-(dimethylcarbamothioylsulfanyl)acetyl]amino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=O)CSC(=S)N(C)C |
| InChI | InChI=1S/C18H20N2O3S3/c1-4-23-17(22)13-10-14(12-8-6-5-7-9-12)26-16(13)19-15(21)11-25-18(24)20(2)3/h5-10H,4,11H2,1-3H3,(H,19,21) |
| InChIKey | KYYIWKYXVQBRIC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|