C20H24N2O3S3 — CID 16530589
ethyl 3-[[2-(diethylcarbamothioylsulfanyl)acetyl]amino]-5-phenylthiophene-2-carboxylate (PubChem CID 16530589) has the molecular formula C20H24N2O3S3 and a molecular weight of 436.62 g/mol. Its IUPAC name is ethyl 3-[[2-(diethylcarbamothioylsulfanyl)acetyl]amino]-5-phenylthiophene-2-carboxylate.
| Compound Name | ethyl 3-[[2-(diethylcarbamothioylsulfanyl)acetyl]amino]-5-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 16530589 |
| Molecular Formula | C20H24N2O3S3 |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | ethyl 3-[[2-(diethylcarbamothioylsulfanyl)acetyl]amino]-5-phenylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccccc2)cc1NC(=O)CSC(=S)N(CC)CC |
| InChI | InChI=1S/C20H24N2O3S3/c1-4-22(5-2)20(26)27-13-17(23)21-15-12-16(14-10-8-7-9-11-14)28-18(15)19(24)25-6-3/h7-12H,4-6,13H2,1-3H3,(H,21,23) |
| InChIKey | RAOSRUWGWXWGSG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|