C24H21NO7S — CID 56504581
2-O-[2-[(2-ethoxycarbonyl-5-phenylthiophen-3-yl)amino]-2-oxoethyl] 1-O-methyl benzene-1,2-dicarboxylate (PubChem CID 56504581) has the molecular formula C24H21NO7S and a molecular weight of 467.50 g/mol. Its IUPAC name is 2-O-[2-[(2-ethoxycarbonyl-5-phenylthiophen-3-yl)amino]-2-oxoethyl] 1-O-methyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[2-[(2-ethoxycarbonyl-5-phenylthiophen-3-yl)amino]-2-oxoethyl] 1-O-methyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 56504581 |
| Molecular Formula | C24H21NO7S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 2-O-[2-[(2-ethoxycarbonyl-5-phenylthiophen-3-yl)amino]-2-oxoethyl] 1-O-methyl benzene-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccccc2)cc1NC(=O)COC(=O)c1ccccc1C(=O)OC |
| InChI | InChI=1S/C24H21NO7S/c1-3-31-24(29)21-18(13-19(33-21)15-9-5-4-6-10-15)25-20(26)14-32-23(28)17-12-8-7-11-16(17)22(27)30-2/h4-13H,3,14H2,1-2H3,(H,25,26) |
| InChIKey | MTNBNNUXPPYWJL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|