C17H16ClNO5S — CID 4857796
ethyl 3-[(2-acetyloxyacetyl)amino]-5-(4-chlorophenyl)thiophene-2-carboxylate (PubChem CID 4857796) has the molecular formula C17H16ClNO5S and a molecular weight of 381.84 g/mol. Its IUPAC name is ethyl 3-[(2-acetyloxyacetyl)amino]-5-(4-chlorophenyl)thiophene-2-carboxylate.
| Compound Name | ethyl 3-[(2-acetyloxyacetyl)amino]-5-(4-chlorophenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 4857796 |
| Molecular Formula | C17H16ClNO5S |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | ethyl 3-[(2-acetyloxyacetyl)amino]-5-(4-chlorophenyl)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccc(Cl)cc2)cc1NC(=O)COC(C)=O |
| InChI | InChI=1S/C17H16ClNO5S/c1-3-23-17(22)16-13(19-15(21)9-24-10(2)20)8-14(25-16)11-4-6-12(18)7-5-11/h4-8H,3,9H2,1-2H3,(H,19,21) |
| InChIKey | AZPBLDBIVDGLJX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |