C21H19NO5S2 — CID 18267403
ethyl 5-phenyl-3-[[2-(2-thiophen-2-ylacetyl)oxyacetyl]amino]thiophene-2-carboxylate (PubChem CID 18267403) has the molecular formula C21H19NO5S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is ethyl 5-phenyl-3-[[2-(2-thiophen-2-ylacetyl)oxyacetyl]amino]thiophene-2-carboxylate.
| Compound Name | ethyl 5-phenyl-3-[[2-(2-thiophen-2-ylacetyl)oxyacetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 18267403 |
| Molecular Formula | C21H19NO5S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | ethyl 5-phenyl-3-[[2-(2-thiophen-2-ylacetyl)oxyacetyl]amino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccccc2)cc1NC(=O)COC(=O)Cc1cccs1 |
| InChI | InChI=1S/C21H19NO5S2/c1-2-26-21(25)20-16(12-17(29-20)14-7-4-3-5-8-14)22-18(23)13-27-19(24)11-15-9-6-10-28-15/h3-10,12H,2,11,13H2,1H3,(H,22,23) |
| InChIKey | AYPJFPXLXGSWLN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |