C21H19NO5S2 — CID 41154223
ethyl 3-[(2-methylsulfonylbenzoyl)amino]-5-phenylthiophene-2-carboxylate (PubChem CID 41154223) has the molecular formula C21H19NO5S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is ethyl 3-[(2-methylsulfonylbenzoyl)amino]-5-phenylthiophene-2-carboxylate.
| Compound Name | ethyl 3-[(2-methylsulfonylbenzoyl)amino]-5-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 41154223 |
| Molecular Formula | C21H19NO5S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | ethyl 3-[(2-methylsulfonylbenzoyl)amino]-5-phenylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccccc2)cc1NC(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C21H19NO5S2/c1-3-27-21(24)19-16(13-17(28-19)14-9-5-4-6-10-14)22-20(23)15-11-7-8-12-18(15)29(2,25)26/h4-13H,3H2,1-2H3,(H,22,23) |
| InChIKey | SXZLFOQPJISVIG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |