C24H25NO5S2 — CID 16837962
ethyl 5-phenyl-3-[[2-(4-propan-2-ylsulfonylphenyl)acetyl]amino]thiophene-2-carboxylate (PubChem CID 16837962) has the molecular formula C24H25NO5S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is ethyl 5-phenyl-3-[[2-(4-propan-2-ylsulfonylphenyl)acetyl]amino]thiophene-2-carboxylate.
| Compound Name | ethyl 5-phenyl-3-[[2-(4-propan-2-ylsulfonylphenyl)acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 16837962 |
| Molecular Formula | C24H25NO5S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | ethyl 5-phenyl-3-[[2-(4-propan-2-ylsulfonylphenyl)acetyl]amino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccccc2)cc1NC(=O)Cc1ccc(S(=O)(=O)C(C)C)cc1 |
| InChI | InChI=1S/C24H25NO5S2/c1-4-30-24(27)23-20(15-21(31-23)18-8-6-5-7-9-18)25-22(26)14-17-10-12-19(13-11-17)32(28,29)16(2)3/h5-13,15-16H,4,14H2,1-3H3,(H,25,26) |
| InChIKey | CUUAACDVCSPOFY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |