C22H21NO3S2 — CID 41044376
ethyl 3-[(4-ethylsulfanylbenzoyl)amino]-5-phenylthiophene-2-carboxylate (PubChem CID 41044376) has the molecular formula C22H21NO3S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is ethyl 3-[(4-ethylsulfanylbenzoyl)amino]-5-phenylthiophene-2-carboxylate.
| Compound Name | ethyl 3-[(4-ethylsulfanylbenzoyl)amino]-5-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 41044376 |
| Molecular Formula | C22H21NO3S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | ethyl 3-[(4-ethylsulfanylbenzoyl)amino]-5-phenylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccccc2)cc1NC(=O)c1ccc(SCC)cc1 |
| InChI | InChI=1S/C22H21NO3S2/c1-3-26-22(25)20-18(14-19(28-20)15-8-6-5-7-9-15)23-21(24)16-10-12-17(13-11-16)27-4-2/h5-14H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | KQGHFSOLEITPKA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |