C20H17NO3S2 — CID 7565351
methyl 3-[(4-methylsulfanylbenzoyl)amino]-5-phenylthiophene-2-carboxylate (PubChem CID 7565351) has the molecular formula C20H17NO3S2 and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl 3-[(4-methylsulfanylbenzoyl)amino]-5-phenylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(4-methylsulfanylbenzoyl)amino]-5-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7565351 |
| Molecular Formula | C20H17NO3S2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | methyl 3-[(4-methylsulfanylbenzoyl)amino]-5-phenylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-c2ccccc2)cc1NC(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C20H17NO3S2/c1-24-20(23)18-16(12-17(26-18)13-6-4-3-5-7-13)21-19(22)14-8-10-15(25-2)11-9-14/h3-12H,1-2H3,(H,21,22) |
| InChIKey | ZSGCFXWZGKCRTF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |