C16H11F3NO4S- — CID 134095767
(Z)-1,1,1-trifluoro-4-[(2-methoxycarbonyl-5-phenylthiophen-3-yl)amino]-4-oxobut-2-en-2-olate (PubChem CID 134095767) has the molecular formula C16H11F3NO4S- and a molecular weight of 370.33 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-[(2-methoxycarbonyl-5-phenylthiophen-3-yl)amino]-4-oxobut-2-en-2-olate.
| Compound Name | (Z)-1,1,1-trifluoro-4-[(2-methoxycarbonyl-5-phenylthiophen-3-yl)amino]-4-oxobut-2-en-2-olate |
|---|---|
| PubChem CID | 134095767 |
| Molecular Formula | C16H11F3NO4S- |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-[(2-methoxycarbonyl-5-phenylthiophen-3-yl)amino]-4-oxobut-2-en-2-olate |
| SMILES | COC(=O)c1sc(-c2ccccc2)cc1NC(=O)/C=C(\[O-])C(F)(F)F |
| InChI | InChI=1S/C16H12F3NO4S/c1-24-15(23)14-10(20-13(22)8-12(21)16(17,18)19)7-11(25-14)9-5-3-2-4-6-9/h2-8,21H,1H3,(H,20,22)/p-1/b12-8- |
| InChIKey | HMSHCJVARBNGSZ-WQLSENKSSA-M |
| XLogP | 2.95 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|