C12H9NaO4S2 — CID 165455794
sodium 2-methoxycarbonyl-5-phenylthiophene-3-sulfinate (PubChem CID 165455794) has the molecular formula C12H9NaO4S2 and a molecular weight of 304.32 g/mol. Its IUPAC name is sodium 2-methoxycarbonyl-5-phenylthiophene-3-sulfinate.
| Compound Name | sodium 2-methoxycarbonyl-5-phenylthiophene-3-sulfinate |
|---|---|
| PubChem CID | 165455794 |
| Molecular Formula | C12H9NaO4S2 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | sodium 2-methoxycarbonyl-5-phenylthiophene-3-sulfinate |
| SMILES | COC(=O)c1sc(-c2ccccc2)cc1S(=O)[O-].[Na+] |
| InChI | InChI=1S/C12H10O4S2.Na/c1-16-12(13)11-10(18(14)15)7-9(17-11)8-5-3-2-4-6-8;/h2-7H,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | AHVXQCPJEDVXGX-UHFFFAOYSA-M |
| XLogP | -0.56 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|